C25H40O2Si — CID 16720381
[(2Z,5E)-3-(4-triethylsilylbuta-1,3-diynyl)trideca-2,5-dienyl] acetate (PubChem CID 16720381) has the molecular formula C25H40O2Si and a molecular weight of 400.68 g/mol. Its IUPAC name is [(2Z,5E)-3-(4-triethylsilylbuta-1,3-diynyl)trideca-2,5-dienyl] acetate.
| Compound Name | [(2Z,5E)-3-(4-triethylsilylbuta-1,3-diynyl)trideca-2,5-dienyl] acetate |
|---|---|
| PubChem CID | 16720381 |
| Molecular Formula | C25H40O2Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | [(2Z,5E)-3-(4-triethylsilylbuta-1,3-diynyl)trideca-2,5-dienyl] acetate |
| SMILES | CCCCCCC/C=C/C/C(C#CC#C[Si](CC)(CC)CC)=C/COC(C)=O |
| InChI | InChI=1S/C25H40O2Si/c1-6-10-11-12-13-14-15-16-19-25(21-22-27-24(5)26)20-17-18-23-28(7-2,8-3)9-4/h15-16,21H,6-14,19,22H2,1-5H3/b16-15+,25-21- |
| InChIKey | ASKIPCFLSFIEHB-LMKQCNKHSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|