C25H40O3Si — CID 134974624
ethyl (2E,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxyheptadeca-2,9-dien-4,6-diynoate (PubChem CID 134974624) has the molecular formula C25H40O3Si and a molecular weight of 416.68 g/mol. Its IUPAC name is ethyl (2E,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxyheptadeca-2,9-dien-4,6-diynoate.
| Compound Name | ethyl (2E,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxyheptadeca-2,9-dien-4,6-diynoate |
|---|---|
| PubChem CID | 134974624 |
| Molecular Formula | C25H40O3Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | ethyl (2E,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxyheptadeca-2,9-dien-4,6-diynoate |
| SMILES | CCCCCCC/C=C\[C@@H](C#CC#C/C=C/C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O3Si/c1-8-10-11-12-13-14-17-20-23(28-29(6,7)25(3,4)5)21-18-15-16-19-22-24(26)27-9-2/h17,19-20,22-23H,8-14H2,1-7H3/b20-17-,22-19+/t23-/m0/s1 |
| InChIKey | QKUYLZYIBMAOCY-QFNJHIHXSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|