C23H40O2Si — CID 135068120
[(Z)-3-methylidene-4-(2-triethylsilylethynyl)dodec-4-en-2-yl] acetate (PubChem CID 135068120) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is [(Z)-3-methylidene-4-(2-triethylsilylethynyl)dodec-4-en-2-yl] acetate.
| Compound Name | [(Z)-3-methylidene-4-(2-triethylsilylethynyl)dodec-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 135068120 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | [(Z)-3-methylidene-4-(2-triethylsilylethynyl)dodec-4-en-2-yl] acetate |
| SMILES | C=C(/C(C#C[Si](CC)(CC)CC)=C/CCCCCCC)C(C)OC(C)=O |
| InChI | InChI=1S/C23H40O2Si/c1-8-12-13-14-15-16-17-23(20(5)21(6)25-22(7)24)18-19-26(9-2,10-3)11-4/h17,21H,5,8-16H2,1-4,6-7H3/b23-17+ |
| InChIKey | NWZIPXQVZMZHIL-HAVVHWLPSA-N |
| XLogP | 6.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|