C10H18FN — CID 167204966
2-(5-fluorohexan-2-yl)-2,3-dihydro-1H-pyrrole (PubChem CID 167204966) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is 2-(5-fluorohexan-2-yl)-2,3-dihydro-1H-pyrrole.
| Compound Name | 2-(5-fluorohexan-2-yl)-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 167204966 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-(5-fluorohexan-2-yl)-2,3-dihydro-1H-pyrrole |
| SMILES | CC(F)CCC(C)C1CC=CN1 |
| InChI | InChI=1S/C10H18FN/c1-8(5-6-9(2)11)10-4-3-7-12-10/h3,7-10,12H,4-6H2,1-2H3 |
| InChIKey | MQEJAQCYPRLVED-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |