C8H12FN — CID 140575139
7-fluoro-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 140575139) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is 7-fluoro-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | 7-fluoro-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 140575139 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 7-fluoro-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | FC1CCCC2C=CNC12 |
| InChI | InChI=1S/C8H12FN/c9-7-3-1-2-6-4-5-10-8(6)7/h4-8,10H,1-3H2 |
| InChIKey | IJTUCTSZHLBSQZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |