C14H24FN — CID 167205008
(3aS,7S)-7-fluoro-3-hexan-3-yl-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 167205008) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is (3aS,7S)-7-fluoro-3-hexan-3-yl-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | (3aS,7S)-7-fluoro-3-hexan-3-yl-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 167205008 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (3aS,7S)-7-fluoro-3-hexan-3-yl-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | CCCC(CC)C1=CNC2[C@@H](F)CCC[C@@H]12 |
| InChI | InChI=1S/C14H24FN/c1-3-6-10(4-2)12-9-16-14-11(12)7-5-8-13(14)15/h9-11,13-14,16H,3-8H2,1-2H3/t10?,11-,13-,14?/m0/s1 |
| InChIKey | GNLOZAUOJSBUTL-QGPNDVEFSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |