C16H29FN2 — CID 174024826
N-[2-[(3aS,6S)-5-fluoro-6-methyl-3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl]ethyl]-N-ethylpropan-1-amine (PubChem CID 174024826) has the molecular formula C16H29FN2 and a molecular weight of 268.42 g/mol. Its IUPAC name is N-[2-[(3aS,6S)-5-fluoro-6-methyl-3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl]ethyl]-N-ethylpropan-1-amine.
| Compound Name | N-[2-[(3aS,6S)-5-fluoro-6-methyl-3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl]ethyl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 174024826 |
| Molecular Formula | C16H29FN2 |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | N-[2-[(3aS,6S)-5-fluoro-6-methyl-3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl]ethyl]-N-ethylpropan-1-amine |
| SMILES | CCCN(CC)CCC1=CNC2C[C@H](C)C(F)C[C@@H]12 |
| InChI | InChI=1S/C16H29FN2/c1-4-7-19(5-2)8-6-13-11-18-16-9-12(3)15(17)10-14(13)16/h11-12,14-16,18H,4-10H2,1-3H3/t12-,14-,15?,16?/m0/s1 |
| InChIKey | TUDCUQDBQIZARM-IQAUEXFUSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |