C12H19F3N2 — CID 162603822
1,1,1-trifluoro-3-(7-methyl-3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl)propan-2-amine (PubChem CID 162603822) has the molecular formula C12H19F3N2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(7-methyl-3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl)propan-2-amine.
| Compound Name | 1,1,1-trifluoro-3-(7-methyl-3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 162603822 |
| Molecular Formula | C12H19F3N2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1,1,1-trifluoro-3-(7-methyl-3a,4,5,6,7,7a-hexahydro-1H-indol-3-yl)propan-2-amine |
| SMILES | CC1CCCC2C(CC(N)C(F)(F)F)=CNC12 |
| InChI | InChI=1S/C12H19F3N2/c1-7-3-2-4-9-8(6-17-11(7)9)5-10(16)12(13,14)15/h6-7,9-11,17H,2-5,16H2,1H3 |
| InChIKey | RJDVJEIMTCXTQU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |