C17H17NOS — CID 16721089
N-(4-methoxyphenyl)-2,3-dimethyl-1-benzothiophen-7-amine (PubChem CID 16721089) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2,3-dimethyl-1-benzothiophen-7-amine.
| Compound Name | N-(4-methoxyphenyl)-2,3-dimethyl-1-benzothiophen-7-amine |
|---|---|
| PubChem CID | 16721089 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(4-methoxyphenyl)-2,3-dimethyl-1-benzothiophen-7-amine |
| SMILES | COc1ccc(Nc2cccc3c(C)c(C)sc23)cc1 |
| InChI | InChI=1S/C17H17NOS/c1-11-12(2)20-17-15(11)5-4-6-16(17)18-13-7-9-14(19-3)10-8-13/h4-10,18H,1-3H3 |
| InChIKey | YEEHZKFKDTWHRQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |