C46H42N4O6 — CID 54565437
4-[3-[2,4-bis(4-methoxyanilino)phenoxy]phenoxy]-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-diamine (PubChem CID 54565437) has the molecular formula C46H42N4O6 and a molecular weight of 746.86 g/mol. Its IUPAC name is 4-[3-[2,4-bis(4-methoxyanilino)phenoxy]phenoxy]-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-diamine.
| Compound Name | 4-[3-[2,4-bis(4-methoxyanilino)phenoxy]phenoxy]-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 54565437 |
| Molecular Formula | C46H42N4O6 |
| Molecular Weight | 746.86 g/mol |
| Exact Mass | 746.31 |
| IUPAC Name | 4-[3-[2,4-bis(4-methoxyanilino)phenoxy]phenoxy]-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-diamine |
| SMILES | COc1ccc(Nc2ccc(Oc3cccc(Oc4ccc(Nc5ccc(OC)cc5)cc4Nc4ccc(OC)cc4)c3)c(Nc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C46H42N4O6/c1-51-37-18-8-31(9-19-37)47-35-16-26-45(43(28-35)49-33-12-22-39(53-3)23-13-33)55-41-6-5-7-42(30-41)56-46-27-17-36(48-32-10-20-38(52-2)21-11-32)29-44(46)50-34-14-24-40(54-4)25-15-34/h5-30,47-50H,1-4H3 |
| InChIKey | ZTMKKYNZMZXSGN-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.86 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |