C19H28N2O — CID 167218965
(1Z,3E)-N-(2-methoxyethyl)-N-methyl-1-(methylideneamino)-4-(3-propan-2-ylphenyl)penta-1,3-dien-1-amine (PubChem CID 167218965) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (1Z,3E)-N-(2-methoxyethyl)-N-methyl-1-(methylideneamino)-4-(3-propan-2-ylphenyl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N-(2-methoxyethyl)-N-methyl-1-(methylideneamino)-4-(3-propan-2-ylphenyl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 167218965 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (1Z,3E)-N-(2-methoxyethyl)-N-methyl-1-(methylideneamino)-4-(3-propan-2-ylphenyl)penta-1,3-dien-1-amine |
| SMILES | C=N/C(=C\C=C(/C)c1cccc(C(C)C)c1)N(C)CCOC |
| InChI | InChI=1S/C19H28N2O/c1-15(2)17-8-7-9-18(14-17)16(3)10-11-19(20-4)21(5)12-13-22-6/h7-11,14-15H,4,12-13H2,1-3,5-6H3/b16-10+,19-11+ |
| InChIKey | GYASKQRYUQSQFQ-GAZRNQOFSA-N |
| XLogP | 4.33 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|