C27H45BrO5 — CID 167219452
[3,4-bis(2-ethylhexoxy)phenyl]methyl 4-bromobutaneperoxoate (PubChem CID 167219452) has the molecular formula C27H45BrO5 and a molecular weight of 529.56 g/mol. Its IUPAC name is [3,4-bis(2-ethylhexoxy)phenyl]methyl 4-bromobutaneperoxoate.
| Compound Name | [3,4-bis(2-ethylhexoxy)phenyl]methyl 4-bromobutaneperoxoate |
|---|---|
| PubChem CID | 167219452 |
| Molecular Formula | C27H45BrO5 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [3,4-bis(2-ethylhexoxy)phenyl]methyl 4-bromobutaneperoxoate |
| SMILES | CCCCC(CC)COc1ccc(COOC(=O)CCCBr)cc1OCC(CC)CCCC |
| InChI | InChI=1S/C27H45BrO5/c1-5-9-12-22(7-3)19-30-25-16-15-24(21-32-33-27(29)14-11-17-28)18-26(25)31-20-23(8-4)13-10-6-2/h15-16,18,22-23H,5-14,17,19-21H2,1-4H3 |
| InChIKey | OHLJXPOPUSKCRL-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|