C33H57BrO5 — CID 177180278
[3,4-bis(2-ethylhexoxy)-5-heptan-3-yloxyphenyl] 4-bromobutanoate (PubChem CID 177180278) has the molecular formula C33H57BrO5 and a molecular weight of 613.72 g/mol. Its IUPAC name is [3,4-bis(2-ethylhexoxy)-5-heptan-3-yloxyphenyl] 4-bromobutanoate.
| Compound Name | [3,4-bis(2-ethylhexoxy)-5-heptan-3-yloxyphenyl] 4-bromobutanoate |
|---|---|
| PubChem CID | 177180278 |
| Molecular Formula | C33H57BrO5 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | [3,4-bis(2-ethylhexoxy)-5-heptan-3-yloxyphenyl] 4-bromobutanoate |
| SMILES | CCCCC(CC)COc1cc(OC(=O)CCCBr)cc(OC(CC)CCCC)c1OCC(CC)CCCC |
| InChI | InChI=1S/C33H57BrO5/c1-7-13-17-26(10-4)24-36-30-22-29(39-32(35)20-16-21-34)23-31(38-28(12-6)19-15-9-3)33(30)37-25-27(11-5)18-14-8-2/h22-23,26-28H,7-21,24-25H2,1-6H3 |
| InChIKey | ZYIJUWNRPWUWMT-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|