C42H78N2O7 — CID 177180317
ethane;4-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]butyl 3,4-bis(2-ethylhexoxy)-5-(2-methylbutoxy)benzoate (PubChem CID 177180317) has the molecular formula C42H78N2O7 and a molecular weight of 723.09 g/mol. Its IUPAC name is ethane;4-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]butyl 3,4-bis(2-ethylhexoxy)-5-(2-methylbutoxy)benzoate.
| Compound Name | ethane;4-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]butyl 3,4-bis(2-ethylhexoxy)-5-(2-methylbutoxy)benzoate |
|---|---|
| PubChem CID | 177180317 |
| Molecular Formula | C42H78N2O7 |
| Molecular Weight | 723.09 g/mol |
| Exact Mass | 722.58 |
| IUPAC Name | ethane;4-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]butyl 3,4-bis(2-ethylhexoxy)-5-(2-methylbutoxy)benzoate |
| SMILES | CC.CCCCC(CC)COc1cc(C(=O)OCCCCN2CCN(CCOCCO)CC2)cc(OCC(C)CC)c1OCC(CC)CCCC |
| InChI | InChI=1S/C40H72N2O7.C2H6/c1-7-12-16-34(10-4)31-48-38-29-36(28-37(47-30-33(6)9-3)39(38)49-32-35(11-5)17-13-8-2)40(44)46-25-15-14-18-41-19-21-42(22-20-41)23-26-45-27-24-43;1-2/h28-29,33-35,43H,7-27,30-32H2,1-6H3;1-2H3 |
| InChIKey | HFFXYMHVFRGLIY-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.09 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|