C43H78N2O7 — CID 177180308
4-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]butyl 3,4,5-tris(2-ethylhexoxy)benzoate (PubChem CID 177180308) has the molecular formula C43H78N2O7 and a molecular weight of 735.10 g/mol. Its IUPAC name is 4-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]butyl 3,4,5-tris(2-ethylhexoxy)benzoate.
| Compound Name | 4-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]butyl 3,4,5-tris(2-ethylhexoxy)benzoate |
|---|---|
| PubChem CID | 177180308 |
| Molecular Formula | C43H78N2O7 |
| Molecular Weight | 735.10 g/mol |
| Exact Mass | 734.58 |
| IUPAC Name | 4-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]butyl 3,4,5-tris(2-ethylhexoxy)benzoate |
| SMILES | CCCCC(CC)COc1cc(C(=O)OCCCCN2CCN(CCOCCO)CC2)cc(OCC(CC)CCCC)c1OCC(CC)CCCC |
| InChI | InChI=1S/C43H78N2O7/c1-7-13-18-36(10-4)33-50-40-31-39(43(47)49-28-17-16-21-44-22-24-45(25-23-44)26-29-48-30-27-46)32-41(51-34-37(11-5)19-14-8-2)42(40)52-35-38(12-6)20-15-9-3/h31-32,36-38,46H,7-30,33-35H2,1-6H3 |
| InChIKey | SVVUNEHEMUIPQI-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.10 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|