C33H58N2O5 — CID 177180268
4-[4-(2-hydroxyethyl)piperazin-1-yl]butyl 3,5-bis(2-ethylhexoxy)benzoate (PubChem CID 177180268) has the molecular formula C33H58N2O5 and a molecular weight of 562.84 g/mol. Its IUPAC name is 4-[4-(2-hydroxyethyl)piperazin-1-yl]butyl 3,5-bis(2-ethylhexoxy)benzoate.
| Compound Name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]butyl 3,5-bis(2-ethylhexoxy)benzoate |
|---|---|
| PubChem CID | 177180268 |
| Molecular Formula | C33H58N2O5 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 562.43 |
| IUPAC Name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]butyl 3,5-bis(2-ethylhexoxy)benzoate |
| SMILES | CCCCC(CC)COc1cc(OCC(CC)CCCC)cc(C(=O)OCCCCN2CCN(CCO)CC2)c1 |
| InChI | InChI=1S/C33H58N2O5/c1-5-9-13-28(7-3)26-39-31-23-30(24-32(25-31)40-27-29(8-4)14-10-6-2)33(37)38-22-12-11-15-34-16-18-35(19-17-34)20-21-36/h23-25,28-29,36H,5-22,26-27H2,1-4H3 |
| InChIKey | QTKXMAVARKDMAR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|