C12H16INO — CID 167220079
6-iodo-2,4-dimethyl-3-(oxan-4-yl)pyridine (PubChem CID 167220079) has the molecular formula C12H16INO and a molecular weight of 317.17 g/mol. Its IUPAC name is 6-iodo-2,4-dimethyl-3-(oxan-4-yl)pyridine.
| Compound Name | 6-iodo-2,4-dimethyl-3-(oxan-4-yl)pyridine |
|---|---|
| PubChem CID | 167220079 |
| Molecular Formula | C12H16INO |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 6-iodo-2,4-dimethyl-3-(oxan-4-yl)pyridine |
| SMILES | Cc1cc(I)nc(C)c1C1CCOCC1 |
| InChI | InChI=1S/C12H16INO/c1-8-7-11(13)14-9(2)12(8)10-3-5-15-6-4-10/h7,10H,3-6H2,1-2H3 |
| InChIKey | ACTOOCGIGACERX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|