C10H13NO4 — CID 105464779
3-methyl-4-(oxan-4-yl)-1,2-oxazole-5-carboxylic acid (PubChem CID 105464779) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-methyl-4-(oxan-4-yl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-methyl-4-(oxan-4-yl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 105464779 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-methyl-4-(oxan-4-yl)-1,2-oxazole-5-carboxylic acid |
| SMILES | Cc1noc(C(=O)O)c1C1CCOCC1 |
| InChI | InChI=1S/C10H13NO4/c1-6-8(7-2-4-14-5-3-7)9(10(12)13)15-11-6/h7H,2-5H2,1H3,(H,12,13) |
| InChIKey | XSLHFLBCYWVAAH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |