C9H10BrNO4 — CID 16722255
4-(2-bromoethyl)-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptane-1-carbaldehyde (PubChem CID 16722255) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is 4-(2-bromoethyl)-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptane-1-carbaldehyde.
| Compound Name | 4-(2-bromoethyl)-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptane-1-carbaldehyde |
|---|---|
| PubChem CID | 16722255 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 4-(2-bromoethyl)-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptane-1-carbaldehyde |
| SMILES | CC12OC(=O)C1(C=O)NC(=O)C2CCBr |
| InChI | InChI=1S/C9H10BrNO4/c1-8-5(2-3-10)6(13)11-9(8,4-12)7(14)15-8/h4-5H,2-3H2,1H3,(H,11,13) |
| InChIKey | PFLBELFXDZYETN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|