C13H10ClFO — CID 167223021
2-[(1E)-2-chlorobuta-1,3-dienyl]-5-fluoro-3-methyl-1-benzofuran (PubChem CID 167223021) has the molecular formula C13H10ClFO and a molecular weight of 236.67 g/mol. Its IUPAC name is 2-[(1E)-2-chlorobuta-1,3-dienyl]-5-fluoro-3-methyl-1-benzofuran.
| Compound Name | 2-[(1E)-2-chlorobuta-1,3-dienyl]-5-fluoro-3-methyl-1-benzofuran |
|---|---|
| PubChem CID | 167223021 |
| Molecular Formula | C13H10ClFO |
| Molecular Weight | 236.67 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-[(1E)-2-chlorobuta-1,3-dienyl]-5-fluoro-3-methyl-1-benzofuran |
| SMILES | C=C/C(Cl)=C\c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C13H10ClFO/c1-3-9(14)6-13-8(2)11-7-10(15)4-5-12(11)16-13/h3-7H,1H2,2H3/b9-6+ |
| InChIKey | LARMYZHFDYFFOU-RMKNXTFCSA-N |
| XLogP | 4.65 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|