C16H20FN3O — CID 110980417
1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-prop-2-enylguanidine (PubChem CID 110980417) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110980417 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/Cc1oc2ccc(F)cc2c1C)NCC |
| InChI | InChI=1S/C16H20FN3O/c1-4-8-19-16(18-5-2)20-10-15-11(3)13-9-12(17)6-7-14(13)21-15/h4,6-7,9H,1,5,8,10H2,2-3H3,(H2,18,19,20) |
| InChIKey | RGZDBTIZVXJNPL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|