C18H26FN3OS — CID 111626880
1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(4-methylsulfanylbutyl)guanidine (PubChem CID 111626880) has the molecular formula C18H26FN3OS and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 111626880 |
| Molecular Formula | C18H26FN3OS |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(4-methylsulfanylbutyl)guanidine |
| SMILES | CCN/C(=N\Cc1oc2ccc(F)cc2c1C)NCCCCSC |
| InChI | InChI=1S/C18H26FN3OS/c1-4-20-18(21-9-5-6-10-24-3)22-12-17-13(2)15-11-14(19)7-8-16(15)23-17/h7-8,11H,4-6,9-10,12H2,1-3H3,(H2,20,21,22) |
| InChIKey | OMWVFLOMDQGBQA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|