C18H19F4IN4OS — CID 111615717
1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111615717) has the molecular formula C18H19F4IN4OS and a molecular weight of 542.34 g/mol. Its IUPAC name is 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111615717 |
| Molecular Formula | C18H19F4IN4OS |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1oc2ccc(F)cc2c1C)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C18H18F4N4OS.HI/c1-3-23-17(25-8-16-26-15(9-28-16)18(20,21)22)24-7-14-10(2)12-6-11(19)4-5-13(12)27-14;/h4-6,9H,3,7-8H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | DSZVESJISYQXAG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|