C20H30FIN4O2 — CID 111021018
1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111021018) has the molecular formula C20H30FIN4O2 and a molecular weight of 504.39 g/mol. Its IUPAC name is 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111021018 |
| Molecular Formula | C20H30FIN4O2 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 1-ethyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1oc2ccc(F)cc2c1C)NCC(C)N1CCOCC1.I |
| InChI | InChI=1S/C20H29FN4O2.HI/c1-4-22-20(23-12-14(2)25-7-9-26-10-8-25)24-13-19-15(3)17-11-16(21)5-6-18(17)27-19;/h5-6,11,14H,4,7-10,12-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | SBOTUSYIMIPGEH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|