C13H22N2O3 — CID 167225834
1-imidazol-1-yl-2-(3-methoxy-3-methylbutoxy)-2-methylpropan-1-one (PubChem CID 167225834) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-imidazol-1-yl-2-(3-methoxy-3-methylbutoxy)-2-methylpropan-1-one.
| Compound Name | 1-imidazol-1-yl-2-(3-methoxy-3-methylbutoxy)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 167225834 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-imidazol-1-yl-2-(3-methoxy-3-methylbutoxy)-2-methylpropan-1-one |
| SMILES | COC(C)(C)CCOC(C)(C)C(=O)n1ccnc1 |
| InChI | InChI=1S/C13H22N2O3/c1-12(2,17-5)6-9-18-13(3,4)11(16)15-8-7-14-10-15/h7-8,10H,6,9H2,1-5H3 |
| InChIKey | JQGLIRTWELRUIJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |