C26H36N6O3 — CID 167226336
1-[[3-[[6-amino-8-methoxy-2-(6-methylheptoxy)purin-9-yl]methyl]phenyl]methyl]pyrrolidin-2-one (PubChem CID 167226336) has the molecular formula C26H36N6O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is 1-[[3-[[6-amino-8-methoxy-2-(6-methylheptoxy)purin-9-yl]methyl]phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[3-[[6-amino-8-methoxy-2-(6-methylheptoxy)purin-9-yl]methyl]phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 167226336 |
| Molecular Formula | C26H36N6O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 1-[[3-[[6-amino-8-methoxy-2-(6-methylheptoxy)purin-9-yl]methyl]phenyl]methyl]pyrrolidin-2-one |
| SMILES | COc1nc2c(N)nc(OCCCCCC(C)C)nc2n1Cc1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C26H36N6O3/c1-18(2)9-5-4-6-14-35-25-29-23(27)22-24(30-25)32(26(28-22)34-3)17-20-11-7-10-19(15-20)16-31-13-8-12-21(31)33/h7,10-11,15,18H,4-6,8-9,12-14,16-17H2,1-3H3,(H2,27,29,30) |
| InChIKey | HAQTUVVKNBJPOP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|