C24H34N4O — CID 167227450
3-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]naphthalen-2-ol (PubChem CID 167227450) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]naphthalen-2-ol.
| Compound Name | 3-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 167227450 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 3-[(1Z,3E)-1,4-diamino-4-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]buta-1,3-dienyl]naphthalen-2-ol |
| SMILES | CN(/C(N)=C/C=C(\N)c1cc2ccccc2cc1O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H34N4O/c1-23(2)14-18(15-24(3,4)27-23)28(5)22(26)11-10-20(25)19-12-16-8-6-7-9-17(16)13-21(19)29/h6-13,18,27,29H,14-15,25-26H2,1-5H3/b20-10-,22-11+ |
| InChIKey | AZIPCSXBSVRNNN-VPAXRDDUSA-N |
| XLogP | 3.89 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|