C18H24ClNO — CID 44531473
1-[[(4-methylcyclohexyl)amino]methyl]naphthalen-2-ol;hydrochloride (PubChem CID 44531473) has the molecular formula C18H24ClNO and a molecular weight of 305.85 g/mol. Its IUPAC name is 1-[[(4-methylcyclohexyl)amino]methyl]naphthalen-2-ol;hydrochloride.
| Compound Name | 1-[[(4-methylcyclohexyl)amino]methyl]naphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 44531473 |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-[[(4-methylcyclohexyl)amino]methyl]naphthalen-2-ol;hydrochloride |
| SMILES | CC1CCC(NCc2c(O)ccc3ccccc23)CC1.Cl |
| InChI | InChI=1S/C18H23NO.ClH/c1-13-6-9-15(10-7-13)19-12-17-16-5-3-2-4-14(16)8-11-18(17)20;/h2-5,8,11,13,15,19-20H,6-7,9-10,12H2,1H3;1H |
| InChIKey | LVCXBTAVRAHILO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|