C15H19F2NO3 — CID 167228891
ethyl 3-[(2R,4S)-4-(3,4-difluorophenoxy)pyrrolidin-2-yl]propanoate (PubChem CID 167228891) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is ethyl 3-[(2R,4S)-4-(3,4-difluorophenoxy)pyrrolidin-2-yl]propanoate.
| Compound Name | ethyl 3-[(2R,4S)-4-(3,4-difluorophenoxy)pyrrolidin-2-yl]propanoate |
|---|---|
| PubChem CID | 167228891 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 3-[(2R,4S)-4-(3,4-difluorophenoxy)pyrrolidin-2-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1C[C@H](Oc2ccc(F)c(F)c2)CN1 |
| InChI | InChI=1S/C15H19F2NO3/c1-2-20-15(19)6-3-10-7-12(9-18-10)21-11-4-5-13(16)14(17)8-11/h4-5,8,10,12,18H,2-3,6-7,9H2,1H3/t10-,12+/m1/s1 |
| InChIKey | ZWYOIJAVMODZMW-PWSUYJOCSA-N |
| XLogP | 2.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |