C25H29ClN6O2 — CID 167233063
tert-butyl 8-(8-chloro-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 167233063) has the molecular formula C25H29ClN6O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is tert-butyl 8-(8-chloro-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 8-(8-chloro-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 167233063 |
| Molecular Formula | C25H29ClN6O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | tert-butyl 8-(8-chloro-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCN(c3nc(-c4ccncc4)nc4c(Cl)nccc34)CC2)C1 |
| InChI | InChI=1S/C25H29ClN6O2/c1-24(2,3)34-23(33)32-15-9-25(16-32)7-13-31(14-8-25)22-18-6-12-28-20(26)19(18)29-21(30-22)17-4-10-27-11-5-17/h4-6,10-12H,7-9,13-16H2,1-3H3 |
| InChIKey | JTRCGHGQFPPMST-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|