C25H29BrN6O2 — CID 167233385
tert-butyl 8-(6-bromo-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 167233385) has the molecular formula C25H29BrN6O2 and a molecular weight of 525.45 g/mol. Its IUPAC name is tert-butyl 8-(6-bromo-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 8-(6-bromo-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 167233385 |
| Molecular Formula | C25H29BrN6O2 |
| Molecular Weight | 525.45 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | tert-butyl 8-(6-bromo-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCN(c3nc(-c4ccncc4)nc4cnc(Br)cc34)CC2)C1 |
| InChI | InChI=1S/C25H29BrN6O2/c1-24(2,3)34-23(33)32-13-8-25(16-32)6-11-31(12-7-25)22-18-14-20(26)28-15-19(18)29-21(30-22)17-4-9-27-10-5-17/h4-5,9-10,14-15H,6-8,11-13,16H2,1-3H3 |
| InChIKey | PPYXXJZPWCVAEO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|