C35H40N4O4 — CID 167233133
N-(5-aminopentyl)-4-[2-(dihydroxymethyl)-3-(3-naphthalen-1-yloxypropyl)pyrazolo[1,5-a]pyridin-7-yl]-3,5-dimethylbenzamide (PubChem CID 167233133) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is N-(5-aminopentyl)-4-[2-(dihydroxymethyl)-3-(3-naphthalen-1-yloxypropyl)pyrazolo[1,5-a]pyridin-7-yl]-3,5-dimethylbenzamide.
| Compound Name | N-(5-aminopentyl)-4-[2-(dihydroxymethyl)-3-(3-naphthalen-1-yloxypropyl)pyrazolo[1,5-a]pyridin-7-yl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 167233133 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | N-(5-aminopentyl)-4-[2-(dihydroxymethyl)-3-(3-naphthalen-1-yloxypropyl)pyrazolo[1,5-a]pyridin-7-yl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)NCCCCCN)cc(C)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(O)O)nn12 |
| InChI | InChI=1S/C35H40N4O4/c1-23-21-26(34(40)37-19-7-3-6-18-36)22-24(2)32(23)30-16-9-15-29-28(33(35(41)42)38-39(29)30)14-10-20-43-31-17-8-12-25-11-4-5-13-27(25)31/h4-5,8-9,11-13,15-17,21-22,35,41-42H,3,6-7,10,14,18-20,36H2,1-2H3,(H,37,40) |
| InChIKey | XAMLVEKKARSAOI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|