C22H27N7S — CID 167233321
N-methylsulfanyl-1-[8-(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decan-3-yl]methanamine (PubChem CID 167233321) has the molecular formula C22H27N7S and a molecular weight of 421.57 g/mol. Its IUPAC name is N-methylsulfanyl-1-[8-(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decan-3-yl]methanamine.
| Compound Name | N-methylsulfanyl-1-[8-(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decan-3-yl]methanamine |
|---|---|
| PubChem CID | 167233321 |
| Molecular Formula | C22H27N7S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-methylsulfanyl-1-[8-(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decan-3-yl]methanamine |
| SMILES | CSNCC1CC2(CCN(c3nc(-c4ccncc4)nc4cnccc34)CC2)CN1 |
| InChI | InChI=1S/C22H27N7S/c1-30-26-13-17-12-22(15-25-17)5-10-29(11-6-22)21-18-4-9-24-14-19(18)27-20(28-21)16-2-7-23-8-3-16/h2-4,7-9,14,17,25-26H,5-6,10-13,15H2,1H3 |
| InChIKey | VDULJYLLTDLABA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|