C23H26N6O — CID 175988940
3-[8-(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decan-2-yl]propanal (PubChem CID 175988940) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[8-(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decan-2-yl]propanal.
| Compound Name | 3-[8-(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decan-2-yl]propanal |
|---|---|
| PubChem CID | 175988940 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-[8-(2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-yl)-2,8-diazaspiro[4.5]decan-2-yl]propanal |
| SMILES | O=CCCN1CCC2(CCN(c3nc(-c4ccncc4)nc4cnccc34)CC2)C1 |
| InChI | InChI=1S/C23H26N6O/c30-15-1-11-28-12-5-23(17-28)6-13-29(14-7-23)22-19-4-10-25-16-20(19)26-21(27-22)18-2-8-24-9-3-18/h2-4,8-10,15-16H,1,5-7,11-14,17H2 |
| InChIKey | RVBSEGNFYQAKBY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|