C15H16O4 — CID 16723531
methyl (2E)-2-[(2S)-8-oxo-2-(2-oxoethyl)spiro[4.5]deca-6,9-dien-3-ylidene]acetate (PubChem CID 16723531) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl (2E)-2-[(2S)-8-oxo-2-(2-oxoethyl)spiro[4.5]deca-6,9-dien-3-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S)-8-oxo-2-(2-oxoethyl)spiro[4.5]deca-6,9-dien-3-ylidene]acetate |
|---|---|
| PubChem CID | 16723531 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl (2E)-2-[(2S)-8-oxo-2-(2-oxoethyl)spiro[4.5]deca-6,9-dien-3-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CC2(C=CC(=O)C=C2)C[C@H]1CC=O |
| InChI | InChI=1S/C15H16O4/c1-19-14(18)8-12-10-15(9-11(12)4-7-16)5-2-13(17)3-6-15/h2-3,5-8,11H,4,9-10H2,1H3/b12-8+/t11-/m1/s1 |
| InChIKey | IIEYFIQQTQPQKW-OYGDSYQHSA-N |
| XLogP | 1.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|