C18H17N3O — CID 167237946
(4E,5E)-4,5-di(ethylidene)-3,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,11,13,15-pentaen-6-one (PubChem CID 167237946) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-3,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,11,13,15-pentaen-6-one.
| Compound Name | (4E,5E)-4,5-di(ethylidene)-3,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,11,13,15-pentaen-6-one |
|---|---|
| PubChem CID | 167237946 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-3,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,11,13,15-pentaen-6-one |
| SMILES | C/C=c1/nc2n(c(=O)/c1=C/C)CCc1c-2[nH]c2ccccc12 |
| InChI | InChI=1S/C18H17N3O/c1-3-11-14(4-2)20-17-16-13(9-10-21(17)18(11)22)12-7-5-6-8-15(12)19-16/h3-8,19H,9-10H2,1-2H3/b11-3+,14-4+ |
| InChIKey | LXDCNKUIJYBBNU-RGMFKVBISA-N |
| XLogP | 1.55 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|