C20H14N2O3 — CID 5320036
16-hydroxy-14-oxo-11,12-dihydro-3H-yohimban-19-carbaldehyde (PubChem CID 5320036) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 16-hydroxy-14-oxo-11,12-dihydro-3H-yohimban-19-carbaldehyde.
| Compound Name | 16-hydroxy-14-oxo-11,12-dihydro-3H-yohimban-19-carbaldehyde |
|---|---|
| PubChem CID | 5320036 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 16-hydroxy-14-oxo-11,12-dihydro-3H-yohimban-19-carbaldehyde |
| SMILES | O=Cc1ccc(O)c2c(=O)n3c(cc12)-c1[nH]c2ccccc2c1CC3 |
| InChI | InChI=1S/C20H14N2O3/c23-10-11-5-6-17(24)18-14(11)9-16-19-13(7-8-22(16)20(18)25)12-3-1-2-4-15(12)21-19/h1-6,9-10,21,24H,7-8H2 |
| InChIKey | LVMGFLUBFFLCIP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|