C23H26N6O — CID 135471595
18-[2-(diethylamino)ethylamino]-3,13,17,21-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one (PubChem CID 135471595) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 18-[2-(diethylamino)ethylamino]-3,13,17,21-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one.
| Compound Name | 18-[2-(diethylamino)ethylamino]-3,13,17,21-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one |
|---|---|
| PubChem CID | 135471595 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 18-[2-(diethylamino)ethylamino]-3,13,17,21-tetrazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one |
| SMILES | CCN(CC)CCNc1cc2nc3n(c(=O)c2cn1)CCc1c-3[nH]c2ccccc12 |
| InChI | InChI=1S/C23H26N6O/c1-3-28(4-2)12-10-24-20-13-19-17(14-25-20)23(30)29-11-9-16-15-7-5-6-8-18(15)26-21(16)22(29)27-19/h5-8,13-14,26H,3-4,9-12H2,1-2H3,(H,24,25) |
| InChIKey | FWEXWRKKFBVEOQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|