C22H21N5O2S — CID 167242985
(E)-2-cyano-N-[(2-morpholin-4-ylsulfanylphenyl)methyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide (PubChem CID 167242985) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is (E)-2-cyano-N-[(2-morpholin-4-ylsulfanylphenyl)methyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(2-morpholin-4-ylsulfanylphenyl)methyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 167242985 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (E)-2-cyano-N-[(2-morpholin-4-ylsulfanylphenyl)methyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c[nH]c2ncccc12)C(=O)NCc1ccccc1SN1CCOCC1 |
| InChI | InChI=1S/C22H21N5O2S/c23-13-17(12-18-15-25-21-19(18)5-3-7-24-21)22(28)26-14-16-4-1-2-6-20(16)30-27-8-10-29-11-9-27/h1-7,12,15H,8-11,14H2,(H,24,25)(H,26,28)/b17-12+ |
| InChIKey | QBHMXLNEMJFJPC-SFQUDFHCSA-N |
| XLogP | 3.13 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|