C10H21FN2O2 — CID 167243534
N-[2-fluoro-3-[2-(propan-2-ylamino)ethoxy]propyl]acetamide (PubChem CID 167243534) has the molecular formula C10H21FN2O2 and a molecular weight of 220.29 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-(propan-2-ylamino)ethoxy]propyl]acetamide.
| Compound Name | N-[2-fluoro-3-[2-(propan-2-ylamino)ethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 167243534 |
| Molecular Formula | C10H21FN2O2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-[2-fluoro-3-[2-(propan-2-ylamino)ethoxy]propyl]acetamide |
| SMILES | CC(=O)NCC(F)COCCNC(C)C |
| InChI | InChI=1S/C10H21FN2O2/c1-8(2)12-4-5-15-7-10(11)6-13-9(3)14/h8,10,12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | KKVWRZZMXJUWTO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|