C26H27NO2 — CID 16724361
methyl 4-[(2-methyl-4,4-diphenylpyrrolidin-1-yl)methyl]benzoate (PubChem CID 16724361) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is methyl 4-[(2-methyl-4,4-diphenylpyrrolidin-1-yl)methyl]benzoate.
| Compound Name | methyl 4-[(2-methyl-4,4-diphenylpyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 16724361 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | methyl 4-[(2-methyl-4,4-diphenylpyrrolidin-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CC(c3ccccc3)(c3ccccc3)CC2C)cc1 |
| InChI | InChI=1S/C26H27NO2/c1-20-17-26(23-9-5-3-6-10-23,24-11-7-4-8-12-24)19-27(20)18-21-13-15-22(16-14-21)25(28)29-2/h3-16,20H,17-19H2,1-2H3 |
| InChIKey | PLRDTHWESOJPLK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |