C28H41N3O4 — CID 167244418
N-[3-[3-[[3-methoxy-4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]propoxy]phenyl]acetamide (PubChem CID 167244418) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is N-[3-[3-[[3-methoxy-4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]propoxy]phenyl]acetamide.
| Compound Name | N-[3-[3-[[3-methoxy-4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 167244418 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | N-[3-[3-[[3-methoxy-4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]propoxy]phenyl]acetamide |
| SMILES | COc1cc(CN(C)CCCOc2cccc(NC(C)=O)c2)ccc1OCCN1CCC(C)CC1 |
| InChI | InChI=1S/C28H41N3O4/c1-22-11-14-31(15-12-22)16-18-35-27-10-9-24(19-28(27)33-4)21-30(3)13-6-17-34-26-8-5-7-25(20-26)29-23(2)32/h5,7-10,19-20,22H,6,11-18,21H2,1-4H3,(H,29,32) |
| InChIKey | SCAHAFIWIFHJMO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|