C28H41N3O5 — CID 174234321
N-[2-hydroxy-3-[[3-methoxy-4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]propoxy]-2-phenylacetamide (PubChem CID 174234321) has the molecular formula C28H41N3O5 and a molecular weight of 499.65 g/mol. Its IUPAC name is N-[2-hydroxy-3-[[3-methoxy-4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]propoxy]-2-phenylacetamide.
| Compound Name | N-[2-hydroxy-3-[[3-methoxy-4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]propoxy]-2-phenylacetamide |
|---|---|
| PubChem CID | 174234321 |
| Molecular Formula | C28H41N3O5 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | N-[2-hydroxy-3-[[3-methoxy-4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]propoxy]-2-phenylacetamide |
| SMILES | COc1cc(CN(C)CC(O)CONC(=O)Cc2ccccc2)ccc1OCCN1CCC(C)CC1 |
| InChI | InChI=1S/C28H41N3O5/c1-22-11-13-31(14-12-22)15-16-35-26-10-9-24(17-27(26)34-3)19-30(2)20-25(32)21-36-29-28(33)18-23-7-5-4-6-8-23/h4-10,17,22,25,32H,11-16,18-21H2,1-3H3,(H,29,33) |
| InChIKey | ADHLYFIPILROJK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|