C19H30O5 — CID 16724677
[(2S)-hept-6-en-2-yl] 3-[(1R,2S,4S)-2-ethenyl-4-(methoxymethoxy)cyclopentyl]-3-oxopropanoate (PubChem CID 16724677) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is [(2S)-hept-6-en-2-yl] 3-[(1R,2S,4S)-2-ethenyl-4-(methoxymethoxy)cyclopentyl]-3-oxopropanoate.
| Compound Name | [(2S)-hept-6-en-2-yl] 3-[(1R,2S,4S)-2-ethenyl-4-(methoxymethoxy)cyclopentyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 16724677 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [(2S)-hept-6-en-2-yl] 3-[(1R,2S,4S)-2-ethenyl-4-(methoxymethoxy)cyclopentyl]-3-oxopropanoate |
| SMILES | C=CCCC[C@H](C)OC(=O)CC(=O)[C@@H]1C[C@@H](OCOC)C[C@H]1C=C |
| InChI | InChI=1S/C19H30O5/c1-5-7-8-9-14(3)24-19(21)12-18(20)17-11-16(23-13-22-4)10-15(17)6-2/h5-6,14-17H,1-2,7-13H2,3-4H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | HMXHCFHSGNXEMT-VVLHAWIVSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|