C14H26O2 — CID 167247206
1-[3-(2-hydroxyethyl)-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]ethanol (PubChem CID 167247206) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-[3-(2-hydroxyethyl)-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]ethanol.
| Compound Name | 1-[3-(2-hydroxyethyl)-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]ethanol |
|---|---|
| PubChem CID | 167247206 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 1-[3-(2-hydroxyethyl)-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]ethanol |
| SMILES | CC(O)C1CC2C(CCO)CCC2CC1C |
| InChI | InChI=1S/C14H26O2/c1-9-7-12-4-3-11(5-6-15)14(12)8-13(9)10(2)16/h9-16H,3-8H2,1-2H3 |
| InChIKey | GVLONKGBOBZLLS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |