C11H18 — CID 154516067
2-(2-cyclopropylethyl)bicyclo[3.1.0]hexane (PubChem CID 154516067) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 2-(2-cyclopropylethyl)bicyclo[3.1.0]hexane.
| Compound Name | 2-(2-cyclopropylethyl)bicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 154516067 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 2-(2-cyclopropylethyl)bicyclo[3.1.0]hexane |
| SMILES | C1CC1CCC1CCC2CC12 |
| InChI | InChI=1S/C11H18/c1-2-8(1)3-4-9-5-6-10-7-11(9)10/h8-11H,1-7H2 |
| InChIKey | KKFTUERWMLOZEG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |