C18H23ClN2O3 — CID 167248086
4-(5-chloropentyl)-2-(6-hydroxy-2-oxopiperidin-3-yl)-3H-isoindol-1-one (PubChem CID 167248086) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is 4-(5-chloropentyl)-2-(6-hydroxy-2-oxopiperidin-3-yl)-3H-isoindol-1-one.
| Compound Name | 4-(5-chloropentyl)-2-(6-hydroxy-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 167248086 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-(5-chloropentyl)-2-(6-hydroxy-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
| SMILES | O=C1NC(O)CCC1N1Cc2c(CCCCCCl)cccc2C1=O |
| InChI | InChI=1S/C18H23ClN2O3/c19-10-3-1-2-5-12-6-4-7-13-14(12)11-21(18(13)24)15-8-9-16(22)20-17(15)23/h4,6-7,15-16,22H,1-3,5,8-11H2,(H,20,23) |
| InChIKey | STZMBBOZDPLFKZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|