C25H29NO — CID 16725119
(E,2R,3S)-3-phenyl-2-(quinolin-3-ylmethyl)non-4-en-1-ol (PubChem CID 16725119) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is (E,2R,3S)-3-phenyl-2-(quinolin-3-ylmethyl)non-4-en-1-ol.
| Compound Name | (E,2R,3S)-3-phenyl-2-(quinolin-3-ylmethyl)non-4-en-1-ol |
|---|---|
| PubChem CID | 16725119 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (E,2R,3S)-3-phenyl-2-(quinolin-3-ylmethyl)non-4-en-1-ol |
| SMILES | CCCC/C=C/[C@H](c1ccccc1)[C@H](CO)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C25H29NO/c1-2-3-4-8-14-24(21-11-6-5-7-12-21)23(19-27)17-20-16-22-13-9-10-15-25(22)26-18-20/h5-16,18,23-24,27H,2-4,17,19H2,1H3/b14-8+/t23-,24+/m0/s1 |
| InChIKey | PJVWQPGHGKWJIT-RUENKOOFSA-N |
| XLogP | 5.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|