C14H15N — CID 167255858
3-methyl-4-(3-methylidenecyclohexa-1,5-dien-1-yl)aniline (PubChem CID 167255858) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-methyl-4-(3-methylidenecyclohexa-1,5-dien-1-yl)aniline.
| Compound Name | 3-methyl-4-(3-methylidenecyclohexa-1,5-dien-1-yl)aniline |
|---|---|
| PubChem CID | 167255858 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-methyl-4-(3-methylidenecyclohexa-1,5-dien-1-yl)aniline |
| SMILES | C=C1C=C(c2ccc(N)cc2C)C=CC1 |
| InChI | InChI=1S/C14H15N/c1-10-4-3-5-12(8-10)14-7-6-13(15)9-11(14)2/h3,5-9H,1,4,15H2,2H3 |
| InChIKey | SKJNFEQBEFMYFC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|