C13H15N — CID 155394306
4-cyclohexa-1,3-dien-1-yl-3-methylaniline (PubChem CID 155394306) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-3-methylaniline.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-3-methylaniline |
|---|---|
| PubChem CID | 155394306 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-3-methylaniline |
| SMILES | Cc1cc(N)ccc1C1=CC=CCC1 |
| InChI | InChI=1S/C13H15N/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11/h2-3,5,7-9H,4,6,14H2,1H3 |
| InChIKey | XDYNGMCVUONARK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|